Loading distributor info...
| Description | Iohexol is a contrast agent. The osmolality of iohexol ranges from 322 mOsm/kg??approximately 1.1 times that of blood plasma??to 844 mOsm/kg, almost three times that of blood. |
|---|
| Catalog Num | A18120 |
|---|---|
| Formula | C19H26I3N3O9 |
| Molecular Weight | 821.14 |
| CAS Number | 66108-95-0 |
| SMILES | CC(=O)N(CC(CO)O)C1=C(C(=C(C(=C1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I |
| Synonyms | Iohexol, Omnipaque, Exypaque, Accudenz, Histodenz, Nycodenz |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (107.17 mM) | |
| Water | 88 mg/mL (107.17 mM) | ||
| Ethanol | 88 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 12.18 mL | 60.89 mL | 121.78 mL |
| 0.5 mM | 2.44 mL | 12.18 mL | 24.36 mL |
| 1 mM | 1.22 mL | 6.09 mL | 12.18 mL |
| 5 mM | 0.24 mL | 1.22 mL | 2.44 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
