ISCK03
Catalog No.: A17162
c-kit inhibitor
ISCK03 is a potent c-kit inhibitor.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | ISCK03 is a potent c-kit inhibitor. |
|---|
| Catalog Num | A17162 |
|---|---|
| Formula | C19H21N3O2S |
| Molecular Weight | 355.45 |
| CAS Number | 945526-43-2 |
| SMILES | O=S(N(C1=CC=C(C(C)(C)C)C=C1)C2=CC=C(N3C=CN=C3)C=C2)=O |
| Synonyms | ISCK 03, ISCK-03 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (174.42 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.13 mL | 140.67 mL | 281.33 mL |
| 0.5 mM | 5.63 mL | 28.13 mL | 56.27 mL |
| 1 mM | 2.81 mL | 14.07 mL | 28.13 mL |
| 5 mM | 0.56 mL | 2.81 mL | 5.63 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2