Larotrectinib (LOXO-101, ARRY-470) is an orally bioavailable, potent, ATP-competitive inhibitor of TRKA, TRKB, and TRKC.
Loading distributor info...
| Description | Larotrectinib (LOXO-101, ARRY-470) is an orally bioavailable, potent, ATP-competitive inhibitor of TRKA, TRKB, and TRKC. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15974 |
|---|---|
| Formula | C21H22F2N6O2 |
| Molecular Weight | 428.44 |
| CAS Number | 1223403-58-4 |
| SMILES | O=C(N1CC[C@@H](C1)O)NC2=C3N=C(N4CCC[C@@H]4C5=CC(F)=CC=C5F)C=CN3N=C2 |
| Synonyms | LOXO 101, LOXO101, ARRY470, ARRY 470 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (198.39 mM) | |
| Water | Insoluble | ||
| Ethanol | 85 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.34 mL | 116.7 mL | 233.4 mL |
| 0.5 mM | 4.67 mL | 23.34 mL | 46.68 mL |
| 1 mM | 2.33 mL | 11.67 mL | 23.34 mL |
| 5 mM | 0.47 mL | 2.33 mL | 4.67 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
