Loading distributor info...
| Description | LOXO-101 is a small molecule that was designed to block the ATP binding site of the TRK family of receptors, with 2 to 20 nM cellular potency against the TRKA, TRKB, and TRKC kinases. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A16239 |
|---|---|
| Formula | C21H24F2N6O6S |
| Molecular Weight | 526.51 |
| CAS Number | 1223405-08-0 |
| SMILES | C1CC(N(C1)C2=NC3=C(C=NN3C=C2)NC(=O)N4CCC(C4)O)C5=C(C=CC(=C5)F)F.OS(=O)(=O)O |
| Synonyms | LOXO101 sulfate, LOXO 101 sulfate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (167.13 mM) | |
| Water | Insoluble | ||
| Ethanol | 88 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.99 mL | 94.96 mL | 189.93 mL |
| 0.5 mM | 3.8 mL | 18.99 mL | 37.99 mL |
| 1 mM | 1.9 mL | 9.5 mL | 18.99 mL |
| 5 mM | 0.38 mL | 1.9 mL | 3.8 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
