Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY2874455 is a novel and potent FGFR/VEGFR Inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11244 |
|---|---|
| Formula | C21H19Cl2N5O2 |
| Molecular Weight | 444.31 |
| CAS Number | 1254473-64-7 |
| SMILES | C[C@H](C1=C(C=NC=C1Cl)Cl)OC2=CC3=C(C=C2)NN=C3/C=C/C4=CN(N=C4)CCO |
| Synonyms | LY-2874455, LY2874455 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 86 mg/mL (193.55 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 56 mg/mL (126.03 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.51 mL | 112.53 mL | 225.07 mL |
| 0.5 mM | 4.5 mL | 22.51 mL | 45.01 mL |
| 1 mM | 2.25 mL | 11.25 mL | 22.51 mL |
| 5 mM | 0.45 mL | 2.25 mL | 4.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
