Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MCB-613 is a potent, pan steroid receptor coactivator (SRC) stimulator. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13415 |
|---|---|
| Formula | C19H19N3O |
| Molecular Weight | 305.37 |
| CAS Number | 1162656-22-5 |
| SMILES | O=C(/C(CN(CC)C/1)=C/C2=CC=CN=C2)C1=C\C3=CN=CC=C3 |
| Synonyms | MCB 613, MCB613 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 54 mg/mL (177.4 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 54 mg/mL (177.4 mM) | ||
| In vivo | 4% DMSO+30% PEG 300+ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.75 mL | 163.74 mL | 327.47 mL |
| 0.5 mM | 6.55 mL | 32.75 mL | 65.49 mL |
| 1 mM | 3.27 mL | 16.37 mL | 32.75 mL |
| 5 mM | 0.65 mL | 3.27 mL | 6.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
