Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | MI-773 is an orally available MDM2 antagonist with Ki of 0.88 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15440 |
|---|---|
| Formula | C29H34Cl2FN3O3 |
| Molecular Weight | 562.5 |
| CAS Number | 1303607-60-4 |
| SMILES | CC(C)(C)C[C@H]1[C@@]2([C@H]([C@@H](N1)C(=O)NC3CCC(CC3)O)C4=C(C(=CC=C4)Cl)F)C5=C(C=C(C=C5)Cl)NC2=O |
| Synonyms | SAR405838,MI 773, MI773 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (165.33 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 29 mg/mL (51.55 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.78 mL | 88.89 mL | 177.78 mL |
| 0.5 mM | 3.56 mL | 17.78 mL | 35.56 mL |
| 1 mM | 1.78 mL | 8.89 mL | 17.78 mL |
| 5 mM | 0.36 mL | 1.78 mL | 3.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
