Loading distributor info...
| Description | Motesanib, also known as AMG-706, is an orally administered multikinase inhibitor that selectively targets VEGF receptors, platelet-derived growth factor receptors, and Kit receptors. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10608 |
|---|---|
| Formula | C22H23N5O.2H3PO4 |
| Molecular Weight | 569.4 |
| CAS Number | 857876-30-3 |
| SMILES | CC1(CNC2=C1C=CC(=C2)NC(=O)C3=C(N=CC=C3)NCC4=CC=NC=C4)C.OP(=O)(O)O.OP(=O)(O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 88 mg/mL (154.54 mM) | |
| Water | Warmed: 17 mg/mL (29.85 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | Saline | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.56 mL | 87.81 mL | 175.62 mL |
| 0.5 mM | 3.51 mL | 17.56 mL | 35.12 mL |
| 1 mM | 1.76 mL | 8.78 mL | 17.56 mL |
| 5 mM | 0.35 mL | 1.76 mL | 3.51 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
