Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | NQDI 1 is a selective inhibitor of apoptosis signal-regulating kinase 1 (ASK1, MAP3K5) (IC50 = 3 μM, Ki = 500 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12838 |
|---|---|
| Formula | C19H13NO4 |
| Molecular Weight | 319.31 |
| CAS Number | 175026-96-7 |
| SMILES | O=C1NC2=CC=CC3=C2C(C4=CC=CC=C4C3=O)=C1C(OCC)=O |
| Synonyms | NQDI-1, NQDI1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 20 mg/mL (62.63 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5%dmso+40%PEG300+5%tween-80+ddH2O | 0.4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.32 mL | 156.59 mL | 313.18 mL |
| 0.5 mM | 6.26 mL | 31.32 mL | 62.64 mL |
| 1 mM | 3.13 mL | 15.66 mL | 31.32 mL |
| 5 mM | 0.63 mL | 3.13 mL | 6.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
