Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NVP-CGM097 is a potent and selective MDM2 inhibitor; an orally bioavailable HDM2 antagonist with potential antineoplastic activity. |
|---|
| Catalog Num | A16326 |
|---|---|
| Formula | C38H47ClN4O4 |
| Molecular Weight | 659.26 |
| CAS Number | 1313363-54-0 |
| SMILES | CC(OC(C=C1[C@]2([H])C3=CC=C(Cl)C=C3)=C(OC)C=C1CC(N2C4=CC=C(N(C[C@@]5([H])CC[C@@](N(CC6=O)CCN6C)([H])CC5)C)C=C4)=O)C |
| Synonyms | CGM097, CGM 097, CGM-097, NVP CGM097 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (94.04 mM) | |
| Water | Insoluble | ||
| Ethanol | 62 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.17 mL | 75.84 mL | 151.69 mL |
| 0.5 mM | 3.03 mL | 15.17 mL | 30.34 mL |
| 1 mM | 1.52 mL | 7.58 mL | 15.17 mL |
| 5 mM | 0.3 mL | 1.52 mL | 3.03 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
