Total item
Cart Subtotal
$0.00 Biological Activity
NVP-TAE226 is a potent FAK inhibitor with IC50 of 5.5 nM and modestly potent to Pyk2(IC50=3.5 nM); 10- to 100-fold less potent against InsR, IGF-1R, ALK, and c-Met.
Targets
| Target | Value |
|---|---|
| PYK2 | IC50: 3.5nM |
| FAK | IC50: 5.5nM |
| Insulin Receptor | IC50: 43.5nM |
| IGF-1R | IC50: 140nM |
| c-Met | IC50: 160nM |
| FLT4 | IC50: 220nM |
| KDR | IC50: 360nM |
| FLT3 | IC50: 480nM |
| CDK1/CyclinB | IC50: 540nM |
| Tek | IC50: 580nM |
| FGFR3(K650E) | IC50: 630nM |
| FGFR1 | IC50: 750nM |
| JAK2 | IC50: 840nM |
| c-Src | IC50: 905nM |
| HER2 | IC50: 945nM |
| RET | IC50: 1.3μM |
| HER1 | IC50: 1.7μM |
| RET(M918T) | IC50: 2.3μM |
| PDK-1 | IC50: 2.4μM |
| PDGFRβ | IC50: 2.6μM |
| FLT1 | IC50: 3.4μM |
| c-Abl | IC50: 5.85μM |
| ZAP70 | IC50: 7.7μM |
| Syk | IC50: 7.9μM |
| PKA | IC50: >10μM |
| PKB | IC50: >10μM |
| C-Raf | IC50: >10μM |
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.32 mL | 106.62 mL | 213.25 mL |
| 0.5 mM | 4.26 mL | 21.32 mL | 42.65 mL |
| 1 mM | 2.13 mL | 10.66 mL | 21.32 mL |
| 5 mM | 0.43 mL | 2.13 mL | 4.26 mL |
*The above data is based on the productmolecular weight 468.94. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Chemical Properties
| Catalog Num | A11507 |
|---|---|
| Actions | Inhibitor |
| M. Wt | 468.94 |
| Formula | C23H25ClN6O3 |
| Solubility | DMSO |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 761437-28-9 |
| Synonyms | TAE226, TAE 226 |
| SMILES | CNC(=O)C1=CC=CC=C1NC2=NC(=NC=C2Cl)NC3=C(C=C(C=C3)N4CCOCC4)OC |
Product Tags
Product Questions
Product Questions
No Questions
Keywords:buy NVP-TAE 226 | NVP-TAE 226 Supplier | purchase NVP-TAE 226 | NVP-TAE 226 cost | NVP-TAE 226 manufacturer | order NVP-TAE 226 | NVP-TAE 226 distributor | buy 761437-28-9| 761437-28-9 Supplier | purchase 761437-28-9 | 761437-28-9 cost | 761437-28-9 manufacturer | order 761437-28-9 | 761437-28-9 distributor
Adooq Quality Guarantee
We promise all products perform as described.