Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NVP-TAE226 is a potent FAK inhibitor with IC50 of 5.5 nM and modestly potent to Pyk2(IC50=3.5 nM); 10- to 100-fold less potent against InsR, IGF-1R, ALK, and c-Met. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11507 |
|---|---|
| Formula | C23H25ClN6O3 |
| Molecular Weight | 468.94 |
| CAS Number | 761437-28-9 |
| SMILES | CNC(=O)C1=CC=CC=C1NC2=NC(=NC=C2Cl)NC3=C(C=C(C=C3)N4CCOCC4)OC |
| Synonyms | TAE226, TAE 226 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 93 mg/mL (198.32 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% methylcellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.32 mL | 106.62 mL | 213.25 mL |
| 0.5 mM | 4.26 mL | 21.32 mL | 42.65 mL |
| 1 mM | 2.13 mL | 10.66 mL | 21.32 mL |
| 5 mM | 0.43 mL | 2.13 mL | 4.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
