Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Olmutinib is a potent small molecule inhibitor of Bruton's tyrosine kinase (BTK). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15976 |
|---|---|
| Formula | C26H26N6O2S |
| Molecular Weight | 486.59 |
| CAS Number | 1353550-13-6 |
| SMILES | C=CC(NC1=CC=CC(OC2=C3C(C=CS3)=NC(NC4=CC=C(N5CCN(C)CC5)C=C4)=N2)=C1)=O |
| Synonyms | HM 61713, HM-61713, BI-1482694, BI1482694, BI 1482694 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (195.23 mM) | |
| Water | Insoluble | ||
| Ethanol | 23 mg/mL (47.26 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.55 mL | 102.76 mL | 205.51 mL |
| 0.5 mM | 4.11 mL | 20.55 mL | 41.1 mL |
| 1 mM | 2.06 mL | 10.28 mL | 20.55 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
