Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | P505-15 (also known as PRT062607) is a novel, highly selective, and orally bioavailable small molecule SYK inhibitor (SYK IC(50) = 1 nM) with anti-SYK activity that is at least 80-fold greater than its affinity for other kinases. |
|---|
| Catalog Num | A11952 |
|---|---|
| Formula | C19H23N9O |
| Molecular Weight | 393.45 |
| CAS Number | 1370261-96-3 |
| SMILES | C1CC[C@H]([C@H](C1)N)NC2=NC=C(C(=N2)NC3=CC(=CC=C3)N4N=CC=N4)C(=O)N |
| Synonyms | P50515, PRT062607 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 85 mg/mL (197.71 mM) | |
| Water | 85 mg/mL (197.71 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | Saline | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.42 mL | 127.08 mL | 254.16 mL |
| 0.5 mM | 5.08 mL | 25.42 mL | 50.83 mL |
| 1 mM | 2.54 mL | 12.71 mL | 25.42 mL |
| 5 mM | 0.51 mL | 2.54 mL | 5.08 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
