Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pazopanib is a potent and selective multi-targeted receptor tyrosine kinase inhibitor of VEGFR-1, VEGFR-2, VEGFR-3, PDGFR-a/β, and c-kit that blocks tumor growth and inhibits angiogenesis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11518 |
|---|---|
| Formula | C21H23N7O2S |
| Molecular Weight | 437.5 |
| CAS Number | 444731-52-6 |
| SMILES | CC1=C(C=C(C=C1)NC2=NC=CC(=N2)N(C)C3=CC4=NN(C(=C4C=C3)C)C)S(=O)(=O)N |
| Synonyms | GW 786034, Votrient,GW786034 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 84 mg/mL (191.98 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.86 mL | 114.29 mL | 228.57 mL |
| 0.5 mM | 4.57 mL | 22.86 mL | 45.71 mL |
| 1 mM | 2.29 mL | 11.43 mL | 22.86 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
