Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pemigatinib is a selective FGFR inhibitor in development for the treatment of patients with cholangiocarcinoma. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20312 |
|---|---|
| Formula | C24H27F2N5O4 |
| Molecular Weight | 487.5 |
| CAS Number | 1513857-77-6 |
| SMILES | CCN(C(N(C(C(F)=C(OC)C=C1OC)=C1F)C2)=O)C(C2=CN3)=C4C3=NC(CN5CCOCC5)=C4 |
| Synonyms | INCB054828; INCB-054828; INCB 054828; INCB54828; INCB 54828; INCB-54828 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 38 mg/mL (77.95 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.51 mL | 102.56 mL | 205.13 mL |
| 0.5 mM | 4.1 mL | 20.51 mL | 41.03 mL |
| 1 mM | 2.05 mL | 10.26 mL | 20.51 mL |
| 5 mM | 0.41 mL | 2.05 mL | 4.1 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
