Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PF-00562271 is the benzenesulfonate salt of PF-562271, which is a potent, ATP-competitive, reversible inhibitor of FAK and Pyk2 with IC50 of 1.5 nM and 14 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12580 |
|---|---|
| Formula | C21H20F3N7O3S.C6H6O3S |
| Molecular Weight | 665.66 |
| CAS Number | 939791-38-5 |
| SMILES | CN(C1=C(C=CC=N1)CNC2=NC(=NC=C2C(F)(F)F)NC3=CC4=C(C=C3)NC(=O)C4)S(=O)(=O)C.C1=CC=C(C=C1)S(=O)(=O)O |
| Synonyms | PF00562271, PF 00562271 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 14 mg/mL (21.03 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 300+ddH2O | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.02 mL | 75.11 mL | 150.23 mL |
| 0.5 mM | 3 mL | 15.02 mL | 30.05 mL |
| 1 mM | 1.5 mL | 7.51 mL | 15.02 mL |
| 5 mM | 0.3 mL | 1.5 mL | 3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
