Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Piceatannol is an anti-inflammatory, immunomodulatory and antiproliferative agent. Inhibits p56lck and syk protein tyrosine kinases and inhibits TNF-induced NF-??B activation and gene expression. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12162 |
|---|---|
| Formula | C14H12O4 |
| Molecular Weight | 244.3 |
| CAS Number | 10083-24-6 |
| SMILES | C1=CC(=C(C=C1/C=C/C2=CC(=CC(=C2)O)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 44 mg/mL (180.14 mM) | |
| Water | Insoluble | ||
| Ethanol | 44 mg/mL (180.14 mM) | ||
| In vivo | 5%DMSO+40% PEG300+5% Tween+50%ddH2O | 3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.93 mL | 204.67 mL | 409.33 mL |
| 0.5 mM | 8.19 mL | 40.93 mL | 81.87 mL |
| 1 mM | 4.09 mL | 20.47 mL | 40.93 mL |
| 5 mM | 0.82 mL | 4.09 mL | 8.19 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
