Pifithrin-α hydrobromide is a reversible inhibitor of p53-mediated apoptosis and p53-dependent gene transcription such as cyclin G, p21/waf1, and mdm2 expression.
Loading distributor info...
| Description | Pifithrin-α hydrobromide is a reversible inhibitor of p53-mediated apoptosis and p53-dependent gene transcription such as cyclin G, p21/waf1, and mdm2 expression. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12451 |
|---|---|
| Formula | C16H18N2OS.HBr |
| Molecular Weight | 367.3 |
| CAS Number | 63208-82-2 |
| SMILES | CC1=CC=C(C=C1)C(=O)CN2C3=C(CCCC3)SC2=N.Br |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 58 mg/mL (157.91 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+ 40% PEG 300+ 5%Tween80+ 50%ddH2O | 3.46 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.23 mL | 136.13 mL | 272.26 mL |
| 0.5 mM | 5.45 mL | 27.23 mL | 54.45 mL |
| 1 mM | 2.72 mL | 13.61 mL | 27.23 mL |
| 5 mM | 0.54 mL | 2.72 mL | 5.45 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
