Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PLX5622 is a highly selective brain penetrant and oral active CSF1R inhibitor with an Ki of 5.9 nM, for extended and specific microglial elimination, preceding and during pathology development. |
|---|
| Catalog Num | A18888 |
|---|---|
| Formula | C21H19F2N5O |
| Molecular Weight | 395.41 |
| CAS Number | 1303420-67-8 |
| SMILES | COC1=NC=C(F)C=C1CNC2=NC(F)=C(CC3=CNC4=NC=C(C)C=C43)C=C2 |
| Synonyms | PLX 5622, PLX-5622 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (179.56 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.29 mL | 126.45 mL | 252.9 mL |
| 0.5 mM | 5.06 mL | 25.29 mL | 50.58 mL |
| 1 mM | 2.53 mL | 12.65 mL | 25.29 mL |
| 5 mM | 0.51 mL | 2.53 mL | 5.06 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
