Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pralsetinib (BLU-667) is a highly potent, selective RET inhibitor. |
|---|
| Catalog Num | A19526 |
|---|---|
| Formula | C27H32FN9O2 |
| Molecular Weight | 533.6 |
| CAS Number | 2097132-94-8 |
| SMILES | O=C([C@@]1(OC)CC[C@H](C2=NC(NC3=NNC(C)=C3)=CC(C)=N2)CC1)N[C@H](C4=CC=C(N5N=CC(F)=C5)N=C4)C |
| Synonyms | BLU-667, BLU 667, BLU667 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (178.03 mM) | |
| Water | Insoluble | ||
| Ethanol | 95 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.74 mL | 93.7 mL | 187.41 mL |
| 0.5 mM | 3.75 mL | 18.74 mL | 37.48 mL |
| 1 mM | 1.87 mL | 9.37 mL | 18.74 mL |
| 5 mM | 0.37 mL | 1.87 mL | 3.75 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
