Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PRT-060318 is a novel selective inhibitor of the tyrosine kinase Syk, as an approach to HIT treatment. |
|---|
| Catalog Num | A15524 |
|---|---|
| Formula | C18H24N6O |
| Molecular Weight | 340.42 |
| CAS Number | 1194961-19-7 |
| SMILES | CC1=CC(=CC=C1)NC2=NC(=NC=C2C(=O)N)NC3CCCCC3N |
| Synonyms | PRT 060318, PRT060318, PRT318, P142?C76. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 66 mg/mL (159.67 mM) | |
| Water | 66 mg/mL (159.67 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | water | 71 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.38 mL | 146.88 mL | 293.75 mL |
| 0.5 mM | 5.88 mL | 29.38 mL | 58.75 mL |
| 1 mM | 2.94 mL | 14.69 mL | 29.38 mL |
| 5 mM | 0.59 mL | 2.94 mL | 5.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
