Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PT2399 is a potent and selective HIF-2α antagonist, which directly binds to HIF-2α PAS B domain with an IC50 of 6 nM. PT2399 displays potent antitumor activity in vivo. |
|---|
| Catalog Num | A19787 |
|---|---|
| Formula | C17H10F5NO4S |
| Molecular Weight | 419.32 |
| CAS Number | 1672662-14-4 |
| SMILES | N#CC1=CC(F)=CC(OC2=CC=C(S(=O)(C(F)F)=O)C3=C2CC(F)(F)[C@H]3O)=C1 |
| Synonyms | PT 2399, PT-2399 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (193.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 81 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.85 mL | 119.24 mL | 238.48 mL |
| 0.5 mM | 4.77 mL | 23.85 mL | 47.7 mL |
| 1 mM | 2.38 mL | 11.92 mL | 23.85 mL |
| 5 mM | 0.48 mL | 2.38 mL | 4.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
