Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Rauwolscine is a natural alkaloid that acts as a selective and reversible α2-adrenergic receptor antagonist (Ki = 12 nM). |
|---|
| Catalog Num | A13426 |
|---|---|
| Formula | C21H27ClN2O3 |
| Molecular Weight | 390.9 |
| CAS Number | 6211-32-1 |
| SMILES | COC(=O)[C@@H]1[C@H](CC[C@H]2[C@@H]1C[C@H]3C4=C(CCN3C2)C5=CC=CC=C5N4)O.Cl |
| Synonyms | Isoyohimbine, NSC 407307, α-Yohimbine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (17.9 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.58 mL | 127.91 mL | 255.82 mL |
| 0.5 mM | 5.12 mL | 25.58 mL | 51.16 mL |
| 1 mM | 2.56 mL | 12.79 mL | 25.58 mL |
| 5 mM | 0.51 mL | 2.56 mL | 5.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
