Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | RN486 is a Bruton's tyrosine kinase (Btk) inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12535 |
|---|---|
| Formula | C35H35FN6O3 |
| Molecular Weight | 606.7 |
| CAS Number | 1242156-23-5 |
| SMILES | CN1CCN(CC1)C2=CN=C(C=C2)NC3=CC(=CN(C3=O)C)C4=C(C(=CC=C4)N5C=CC6=CC(=CC(=C6C5=O)F)C7CC7)CO |
| Synonyms | RN-486,RN 486 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 61 mg/mL (100.54 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+30% PEG 300+10% Tween 80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.48 mL | 82.41 mL | 164.83 mL |
| 0.5 mM | 3.3 mL | 16.48 mL | 32.97 mL |
| 1 mM | 1.65 mL | 8.24 mL | 16.48 mL |
| 5 mM | 0.33 mL | 1.65 mL | 3.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
