Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SGX-523 is an orally bioavailable small molecule, specifically binds to c-Met protein, or HGFR, preventing binding of HGF and disrupting the MET signaling pathway. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10839 |
|---|---|
| Formula | C18H13N7S |
| Molecular Weight | 359.4 |
| CAS Number | 1022150-57-7 |
| SMILES | CN1C=C(C=N1)C2=NN3C(=NN=C3SC4=CC5=C(C=C4)N=CC=C5)C=C2 |
| Synonyms | SGX523 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 3 mg/mL (8.34 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% methylcellulose+0.2% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.82 mL | 139.12 mL | 278.24 mL |
| 0.5 mM | 5.56 mL | 27.82 mL | 55.65 mL |
| 1 mM | 2.78 mL | 13.91 mL | 27.82 mL |
| 5 mM | 0.56 mL | 2.78 mL | 5.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
