Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SSR128129E is an orally-active and allosteric FGFR1 inhibitor with IC50 of 1.9 uM | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13211 |
|---|---|
| Formula | C18H15N2O4.Na |
| Molecular Weight | 346.31 |
| CAS Number | 848318-25-2 |
| SMILES | CC1=C(N2C=CC=CC2=C1OC)C(=O)C3=CC(=C(C=C3)N)C(=O)[O-].[Na+] |
| Synonyms | SSR |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (173.25 mM) | |
| Water | 1 mg/mL (2.88 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.88 mL | 144.38 mL | 288.76 mL |
| 0.5 mM | 5.78 mL | 28.88 mL | 57.75 mL |
| 1 mM | 2.89 mL | 14.44 mL | 28.88 mL |
| 5 mM | 0.58 mL | 2.89 mL | 5.78 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
