Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SUN11602 is a novel aniline compound with basic fibroblast growth factor-like activity. |
|---|
| Catalog Num | A20323 |
|---|---|
| Formula | C26H37N5O2 |
| Molecular Weight | 451.6 |
| CAS Number | 704869-38-5 |
| SMILES | O=C(N)C1=CC=C(CN2CCC(N(C(CNC3=C(C)C(C)=C(N)C(C)=C3C)=O)C)CC2)C=C1 |
| Synonyms | SUN 11602, SUN-11602 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 86 mg/mL (190.43 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 30 mg/mL (66.43 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.14 mL | 110.72 mL | 221.43 mL |
| 0.5 mM | 4.43 mL | 22.14 mL | 44.29 mL |
| 1 mM | 2.21 mL | 11.07 mL | 22.14 mL |
| 5 mM | 0.44 mL | 2.21 mL | 4.43 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
