Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tie2 kinase inhibitor is a potent and selective Tie2 inhibitor with IC50 of 0.25 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10932 |
|---|---|
| Formula | C26H21N3O2S |
| Molecular Weight | 439.5 |
| CAS Number | 948557-43-5 |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C3=C(NC(=N3)C4=CC=C(C=C4)S(=O)C)C5=CC=NC=C5 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 35 mg/mL (79.63 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% Cremophor EL, 2% N,N-dimethylacetamide | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.75 mL | 113.77 mL | 227.53 mL |
| 0.5 mM | 4.55 mL | 22.75 mL | 45.51 mL |
| 1 mM | 2.28 mL | 11.38 mL | 22.75 mL |
| 5 mM | 0.46 mL | 2.28 mL | 4.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
