Tipiralacil hydrochloride, also known as TPI, is a thymidine phosphorylase inhibitor (TPI).
Loading distributor info...
| Description | Tipiralacil hydrochloride, also known as TPI, is a thymidine phosphorylase inhibitor (TPI). |
|---|
| Catalog Num | A13098 |
|---|---|
| Formula | C9H12Cl2N4O2 |
| Molecular Weight | 279.12 |
| CAS Number | 183204-72-0 |
| SMILES | C1CC(=N)N(C1)CC2=C(C(=O)NC(=O)N2)Cl.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (25.08 mM) | |
| Water | 50 mg/mL (179.13 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.83 mL | 179.13 mL | 358.27 mL |
| 0.5 mM | 7.17 mL | 35.83 mL | 71.65 mL |
| 1 mM | 3.58 mL | 17.91 mL | 35.83 mL |
| 5 mM | 0.72 mL | 3.58 mL | 7.17 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
