Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | VH-298 is a highly potent inhibitor of the VHL:HIF-α interaction with a Kd value of 80 to 90 nM, used in PROTAC technology. |
|---|
| Catalog Num | A20326 |
|---|---|
| Formula | C27H33N5O4S |
| Molecular Weight | 523.65 |
| CAS Number | 2097381-85-4 |
| SMILES | O=C([C@H]1N(C([C@H](C(C)(C)C)NC(C2(CC2)C#N)=O)=O)C[C@H](O)C1)NCC3=CC=C(C4=C(C)N=CS4)C=C3 |
| Synonyms | VH 298; VH298 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (168.04 mM) | |
| Water | Insoluble | ||
| Ethanol | 88 mg/mL (168.04 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.1 mL | 95.48 mL | 190.97 mL |
| 0.5 mM | 3.82 mL | 19.1 mL | 38.19 mL |
| 1 mM | 1.91 mL | 9.55 mL | 19.1 mL |
| 5 mM | 0.38 mL | 1.91 mL | 3.82 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
