YH239-EE
YH239-EE is a potent p53-MDM2 antagonist and an apoptosis inducer.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | YH239-EE is a potent p53-MDM2 antagonist and an apoptosis inducer. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14118 |
|---|---|
| Formula | C25H27Cl2N3O4 |
| Molecular Weight | 504.41 |
| CAS Number | 1364488-67-4 |
| SMILES | CCOC(=O)C1=C(C2=C(N1)C=C(C=C2)Cl)C(C(=O)NC(C)(C)C)N(CC3=CC=C(C=C3)Cl)C=O |
| Synonyms | YH239EE |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (168.51 mM) | |
| Water | Insoluble | ||
| Ethanol | 15 mg/mL (29.73 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.83 mL | 99.13 mL | 198.25 mL |
| 0.5 mM | 3.97 mL | 19.83 mL | 39.65 mL |
| 1 mM | 1.98 mL | 9.91 mL | 19.83 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.97 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2