5-hydroxymethyl tolterodine is a metabolite of Tolterodine, a muscarinic receptor antagonist used in the treatment of urinary incontinence.
Loading distributor info...
| Description | 5-hydroxymethyl tolterodine is a metabolite of Tolterodine, a muscarinic receptor antagonist used in the treatment of urinary incontinence. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11166 |
|---|---|
| Formula | C22H31NO2 |
| Molecular Weight | 341.49 |
| CAS Number | 207679-81-0 |
| SMILES | CC(C)N(CC[C@H](C1=CC=CC=C1)C2=C(C=CC(=C2)CO)O)C(C)C |
| Synonyms | (R)-5-Hydroxymethyl tolterodine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (175.69 mM) | |
| Water | Insoluble | ||
| Ethanol | 60 mg/mL (175.69 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.28 mL | 146.42 mL | 292.83 mL |
| 0.5 mM | 5.86 mL | 29.28 mL | 58.57 mL |
| 1 mM | 2.93 mL | 14.64 mL | 29.28 mL |
| 5 mM | 0.59 mL | 2.93 mL | 5.86 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
