Loading distributor info...
| Description | Abametapir is the active ingredient of Xeglyze Lotion. Abametapir inhibits metalloproteinases; enzymes that are essential to physiological processes critical for egg development and the survival of nymph and adult lice. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A15945 |
|---|---|
| Formula | C12H12N2 |
| Molecular Weight | 184.24 |
| CAS Number | 1762-34-1 |
| SMILES | CC1=CN=C(C2=NC=C(C)C=C2)C=C1 |
| Synonyms | HA-44, HA44, HA 44, BRN 0123183, BRN-0123183, BRN0123183, Xeglyze, 6,6'-Bi-3-picoline |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 34 mg/mL (184.54 mM) | |
| Ethanol | <1 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 54.28 mL | 271.39 mL | 542.77 mL |
| 0.5 mM | 10.86 mL | 54.28 mL | 108.55 mL |
| 1 mM | 5.43 mL | 27.14 mL | 54.28 mL |
| 5 mM | 1.09 mL | 5.43 mL | 10.86 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
