Loading distributor info...
| Description | Albendazole is a member of the benzimidazole compounds used as a drug indicated for the treatment of a variety of worm infestations. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10049 |
|---|---|
| Formula | C12H15N3O2S |
| Molecular Weight | 265.33 |
| CAS Number | 54965-21-8 |
| SMILES | CCCSC1=CC2=C(C=C1)N=C(N2)NC(=O)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 16 mg/mL (60.3 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.69 mL | 188.44 mL | 376.89 mL |
| 0.5 mM | 7.54 mL | 37.69 mL | 75.38 mL |
| 1 mM | 3.77 mL | 18.84 mL | 37.69 mL |
| 5 mM | 0.75 mL | 3.77 mL | 7.54 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
