Amygdalin is a glycoside initially isolated from the seeds of the tree Prunus dulcis. Amygdalin induces apoptosis through regulation of Bax and Bcl-2 expressions in human DU145 and LNCaP prostate cancer cells.
Loading distributor info...
| Description | Amygdalin is a glycoside initially isolated from the seeds of the tree Prunus dulcis. Amygdalin induces apoptosis through regulation of Bax and Bcl-2 expressions in human DU145 and LNCaP prostate cancer cells. |
|---|
| Catalog Num | A10074 |
|---|---|
| Formula | C20H27NO11 |
| Molecular Weight | 457.4 |
| CAS Number | 29883-15-6 |
| SMILES | C1=CC=C(C=C1)[C@H](C#N)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (172.7 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.86 mL | 109.31 mL | 218.63 mL |
| 0.5 mM | 4.37 mL | 21.86 mL | 43.73 mL |
| 1 mM | 2.19 mL | 10.93 mL | 21.86 mL |
| 5 mM | 0.44 mL | 2.19 mL | 4.37 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
