Loading distributor info...
| Description | AS1842856 is a cell-permeable inhibitor that blocks the transcription activity of Foxo1 with IC50 of 33 nM. It could directly bind to the active Foxo1, but not the Ser256-phosphorylated form. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15871 |
|---|---|
| Formula | C18H22FN3O3 |
| Molecular Weight | 347.38 |
| CAS Number | 836620-48-5 |
| SMILES | O=C1C(C(O)=O)=CN(CC)C2=C1C(N)=C(F)C(NC3CCCCC3)=C2 |
| Synonyms | AS 1842856, AS-1842856 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 23 mg/mL (66.2 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.79 mL | 143.93 mL | 287.87 mL |
| 0.5 mM | 5.76 mL | 28.79 mL | 57.57 mL |
| 1 mM | 2.88 mL | 14.39 mL | 28.79 mL |
| 5 mM | 0.58 mL | 2.88 mL | 5.76 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
