Loading distributor info...
| Description | AS703026 is a novel, selective, orally bioavailable MEK1/2 inhibitor that inhibits growth and survival of MM cells and cytokine-induced osteoclast differentiation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10089 |
|---|---|
| Formula | C15H15FIN3O3 |
| Molecular Weight | 431.2 |
| CAS Number | 1236699-92-5 |
| SMILES | C1=CC(=C(C=C1I)F)NC2=C(C=CN=C2)C(=O)NC[C@@H](CO)O |
| Synonyms | MSC1936369B |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 78 mg/mL (180.89 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% CMC+0.25% Tween 80 | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.19 mL | 115.96 mL | 231.91 mL |
| 0.5 mM | 4.64 mL | 23.19 mL | 46.38 mL |
| 1 mM | 2.32 mL | 11.6 mL | 23.19 mL |
| 5 mM | 0.46 mL | 2.32 mL | 4.64 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
