Loading distributor info...
| Description | AZD8186 is an isoform-specific small-molecule PI3K inhibitor, potently inhibits PI3Kβ (IC50=4 nM) and PI3Kδ (IC50=12 nM) with selectivity over PI3Kα (IC50=35 nM) and PI3Kγ (IC50=675 nM). | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15759 |
|---|---|
| Formula | C24H25F2N3O4 |
| Molecular Weight | 457.47 |
| CAS Number | 1627494-13-6 |
| SMILES | CC(C1=C2C(=CC(=C1)C(=O)N(C)C)C(=O)C=C(O2)N3CCOCC3)NC4=CC(=CC(=C4)F)F |
| Synonyms | AZD 8186, AZD-8186 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 82 mg/mL (179.25 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 32 mg/mL (69.94 mM) | ||
| In vivo | 10% DMSO + 60% TEG+ 30% WFI | 15 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.86 mL | 109.3 mL | 218.59 mL |
| 0.5 mM | 4.37 mL | 21.86 mL | 43.72 mL |
| 1 mM | 2.19 mL | 10.93 mL | 21.86 mL |
| 5 mM | 0.44 mL | 2.19 mL | 4.37 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
