BMS-707035
BMS-707035 is an HIV-1 integrase (IN) inhibitor. HIV-1 integrase (IN) represents a therapeutically advantageous viral target to treat HIV/AIDS in the clinic.
Loading distributor info...
BMS-707035 is an HIV-1 integrase (IN) inhibitor. HIV-1 integrase (IN) represents a therapeutically advantageous viral target to treat HIV/AIDS in the clinic.
Loading distributor info...
| Description | BMS-707035 is an HIV-1 integrase (IN) inhibitor. HIV-1 integrase (IN) represents a therapeutically advantageous viral target to treat HIV/AIDS in the clinic. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10156 |
|---|---|
| Formula | C17H19FN4O5S |
| Molecular Weight | 410.4 |
| CAS Number | 729607-74-3 |
| SMILES | CN1C(=O)C(=C(N=C1N2CCCCS2(=O)=O)C(=O)NCC3=CC=C(C=C3)F)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 32 mg/mL (77.96 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.37 mL | 121.83 mL | 243.66 mL |
| 0.5 mM | 4.87 mL | 24.37 mL | 48.73 mL |
| 1 mM | 2.44 mL | 12.18 mL | 24.37 mL |
| 5 mM | 0.49 mL | 2.44 mL | 4.87 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2