Chlorogenic acid is an important intermediate in lignin biosynthesis. This compound, long known as an antioxidant, also slows the release of glucose into the bloodstream after a meal.
Loading distributor info...
| Description | Chlorogenic acid is an important intermediate in lignin biosynthesis. This compound, long known as an antioxidant, also slows the release of glucose into the bloodstream after a meal. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10202 |
|---|---|
| Formula | C16H18O9 |
| Molecular Weight | 354.3 |
| CAS Number | 327-97-9 |
| SMILES | C1[C@H]([C@H]([C@@H](C[C@@]1(C(=O)O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (174.98 mM) | |
| Water | 16 mg/mL (45.16 mM) | ||
| Ethanol | 62 mg/mL (174.98 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.22 mL | 141.12 mL | 282.25 mL |
| 0.5 mM | 5.64 mL | 28.22 mL | 56.45 mL |
| 1 mM | 2.82 mL | 14.11 mL | 28.22 mL |
| 5 mM | 0.56 mL | 2.82 mL | 5.64 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
