Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Deoxycholic acid, extracted from Pig bile, Suitability:Ethanol,ether,three oxygen methane,acetone,acetic acid,alkali hydroxide and alkali carbonate solution. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14952 |
|---|---|
| Formula | C24H40O4 |
| Molecular Weight | 392.58 |
| CAS Number | 83-44-3 |
| SMILES | CC(CCC(=O)O)C1CCC2C1(C(CC3C2CCC4C3(CCC(C4)O)C)O)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (168.12 mM) | |
| Water | Insoluble | ||
| Ethanol | 51 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.47 mL | 127.36 mL | 254.73 mL |
| 0.5 mM | 5.09 mL | 25.47 mL | 50.95 mL |
| 1 mM | 2.55 mL | 12.74 mL | 25.47 mL |
| 5 mM | 0.51 mL | 2.55 mL | 5.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
