Loading distributor info...
| Description | Diphenyleneiodonium chloride has been shown to be a potent irreversible inhibitor of NOS2 (iNOS) from macrophages and NOS3 (eNOS) from endothelial cells. |
|---|
| Catalog Num | A13359 |
|---|---|
| Formula | C12H8l.Cl |
| Molecular Weight | 314.55 |
| CAS Number | 4673-26-1 |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3[I+]2.[Cl-] |
| Synonyms | Dibenziodolium chloride; DPI Chloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 12 mg/mL (38.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 3% DMSO+40% PEG 300+2% Tween 80+ddH2O | 0.4 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.79 mL | 158.96 mL | 317.91 mL |
| 0.5 mM | 6.36 mL | 31.79 mL | 63.58 mL |
| 1 mM | 3.18 mL | 15.9 mL | 31.79 mL |
| 5 mM | 0.64 mL | 3.18 mL | 6.36 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
