Loading distributor info...
| Description | FTI-277 HCl is an inhibitor of farnesyl transferase (FTase); a highly potent Ras CAAX peptidomimetic which antagonizes both H- and K-Ras oncogenic signaling. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14439 |
|---|---|
| Formula | C22H30ClN3O3S2 |
| Molecular Weight | 484.07 |
| CAS Number | 180977-34-8 |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)C1=C(C=C(C=C1)NC[C@H](CS)N)C2=CC=CC=C2.Cl |
| Synonyms | FTI 277, FTI277 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (185.92 mM) | |
| Water | 16 mg/mL (33.04 mM) | ||
| Ethanol | Warmed: 13 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.66 mL | 103.29 mL | 206.58 mL |
| 0.5 mM | 4.13 mL | 20.66 mL | 41.32 mL |
| 1 mM | 2.07 mL | 10.33 mL | 20.66 mL |
| 5 mM | 0.41 mL | 2.07 mL | 4.13 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
