Loading distributor info...
| Description | GSK2193874 was identified as a selective, orally active TRPV4 blocker that inhibits Ca(2+) influx through recombinant TRPV4 channels and native endothelial TRPV4 currents. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A14201 |
|---|---|
| Formula | C37H38BrF3N4O |
| Molecular Weight | 691.62 |
| CAS Number | 1336960-13-4 |
| SMILES | C1CCN(CC1)C2CCN(CC2)CC3=C(N=C4C=C(C=CC4=C3C(=O)NC5(CC5)C6=CC=CC=C6)Br)C7=CC(=CC=C7)C(F)(F)F |
| Synonyms | GSK 2193874, GSK2193874 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (137.35 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 48 mg/mL (69.4 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.46 mL | 72.29 mL | 144.59 mL |
| 0.5 mM | 2.89 mL | 14.46 mL | 28.92 mL |
| 1 mM | 1.45 mL | 7.23 mL | 14.46 mL |
| 5 mM | 0.29 mL | 1.45 mL | 2.89 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
