Loading distributor info...
| Description | GSK137647A is a selective FFA4 agonist, with pEC50 of 6.3, 6.2, and 6.1 for human, Mouse and Rat FFA4, respectively. |
|---|
| Catalog Num | A14542 |
|---|---|
| Formula | C16H19NO3S |
| Molecular Weight | 305.39 |
| CAS Number | 349085-82-1 |
| SMILES | COC1=CC=C(S(NC2=C(C)C=C(C)C=C2C)(=O)=O)C=C1 |
| Synonyms | GSK-137647A, GSK 137647A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (196.47 mM) | |
| Water | Insoluble | ||
| Ethanol | 10 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.75 mL | 163.73 mL | 327.45 mL |
| 0.5 mM | 6.55 mL | 32.75 mL | 65.49 mL |
| 1 mM | 3.27 mL | 16.37 mL | 32.75 mL |
| 5 mM | 0.65 mL | 3.27 mL | 6.55 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
