Loading distributor info...
| Description | Haematoxylin is extracted from the heartwood of the logwood tree.When oxidized it forms haematein, a compound that forms strongly coloured complexes with certain metal ions, the most notable ones being Fe(III) and Al(III) salts. Metal-haematein complexes are used to stain cell nuclei prior to examination under a microscope. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10447 |
|---|---|
| Formula | C16H14O6 |
| Molecular Weight | 302.3 |
| CAS Number | 517-28-2 |
| SMILES | C1C2=CC(=C(C=C2C3C1(COC4=C3C=CC(=C4O)O)O)O)O |
| Synonyms | Natural Black 1, C.I. 75290 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (178.63 mM) | |
| Water | 54 mg/mL (178.63 mM) | ||
| Ethanol | 54 mg/mL (178.63 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.08 mL | 165.4 mL | 330.8 mL |
| 0.5 mM | 6.62 mL | 33.08 mL | 66.16 mL |
| 1 mM | 3.31 mL | 16.54 mL | 33.08 mL |
| 5 mM | 0.66 mL | 3.31 mL | 6.62 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
