Attention California Residents: This product can expose you to chemicals including Ifosfamide, which is known to the State of California to cause cancer and birth defects or other reproductive harm. For more information, go to www.P65Warnings.ca.gov
Loading distributor info...
| Description | Ifosfamide is a cytostatic agent that is structurally related to cyclophosphamide. |
|---|
| Catalog Num | A10466 |
|---|---|
| Formula | C7H15Cl2N2O2P |
| Molecular Weight | 261.09 |
| CAS Number | 3778-73-2 |
| SMILES | C1CN(P(=O)(OC1)NCCCl)CCCl |
| Synonyms | Isophosphamide |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (187.67 mM) | |
| Water | 49 mg/mL (187.67 mM) | ||
| Ethanol | 49 mg/mL (187.67 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.3 mL | 191.5 mL | 383.01 mL |
| 0.5 mM | 7.66 mL | 38.3 mL | 76.6 mL |
| 1 mM | 3.83 mL | 19.15 mL | 38.3 mL |
| 5 mM | 0.77 mL | 3.83 mL | 7.66 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
