Loading distributor info...
| Description | Imipramine Hydrochloride is a tricyclic antidepressant. Inhibits the serotonin and norepinephrine transporters but has little effect on the dopamine transporter. |
|---|
| Catalog Num | A13410 |
|---|---|
| Formula | C19H25ClN2 |
| Molecular Weight | 316.9 |
| CAS Number | 113-52-0 |
| SMILES | CN(C)CCCN1C2=CC=CC=C2CCC3=CC=CC=C31.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (195.65 mM) | |
| Water | 62 mg/mL (195.65 mM) | ||
| Ethanol | 62 mg/mL (195.65 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.56 mL | 157.78 mL | 315.56 mL |
| 0.5 mM | 6.31 mL | 31.56 mL | 63.11 mL |
| 1 mM | 3.16 mL | 15.78 mL | 31.56 mL |
| 5 mM | 0.63 mL | 3.16 mL | 6.31 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
