Loading distributor info...
| Description | KN-92 is an inactive derivative of KN-93. KN-93 is a selective inhibitor of Ca2+/calmodulin-dependent kinase II (CaMKII), competitively blocking CaM binding to the kinase (Ki = 370 nM). |
|---|
| Catalog Num | A15139 |
|---|---|
| Formula | C24H28ClN2O7PS |
| Molecular Weight | 554.98 |
| CAS Number | 1135280-28-2 |
| SMILES | CN(CC=CC1=CC=C(C=C1)Cl)CC2=CC=CC=C2NS(=O)(=O)C3=CC=C(C=C3)OC.OP(=O)(O)O |
| Synonyms | KN 92 phosphate, KN92 phosphate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (153.15 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (16.21 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.02 mL | 90.09 mL | 180.19 mL |
| 0.5 mM | 3.6 mL | 18.02 mL | 36.04 mL |
| 1 mM | 1.8 mL | 9.01 mL | 18.02 mL |
| 5 mM | 0.36 mL | 1.8 mL | 3.6 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
