Loading distributor info...
| Description | Mdivi-1 is a selective cell-permeable inhibitor of mitochondrial division DRP1 (dynamin-related GTPase) and mitochondrial division Dynamin I (Dnm1) with IC50 of 1-10 uM. | ||
|---|---|---|---|
| Targets |
| ||
| In Vitro | In the ganglion cell layer (GCL), Mdivi-1 exhibits strong immunoreactivity. Twelve hours following ischemic induction, Mdivi-1 significantly increases protein expression within the GCL. It notably reduces the expression of GFAP protein without altering Drp1 protein expression. In the normal murine retina, Mdivi-1 primarily localizes to the inner plexiform layer, ganglion cell layer, outer plexiform layer, and inner nuclear layer. Early in the development of the ischemic murine retina, there is a marked increase in the protein expression of Mdivi-1 and glial fibrillary acidic protein (GFAP). Mdivi-1 inhibits apoptosis in the ischemic retina and significantly increases the survival rate of retinal ganglion cells (RGC) two weeks post-ischemia. |
| Catalog Num | A14316 |
|---|---|
| Formula | C15H10Cl2N2O2S |
| Molecular Weight | 353.22 |
| CAS Number | 338967-87-6 |
| SMILES | COC1=C(C=C(C(=C1)N2C(=O)C3=CC=CC=C3NC2=S)Cl)Cl |
| Synonyms | Mdivi 1, Mdivi1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 62 mg/mL (175.52 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+40% PEG 300+5% Tween 80+ddH2O | 6 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.31 mL | 141.55 mL | 283.11 mL |
| 0.5 mM | 5.66 mL | 28.31 mL | 56.62 mL |
| 1 mM | 2.83 mL | 14.16 mL | 28.31 mL |
| 5 mM | 0.57 mL | 2.83 mL | 5.66 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
